| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:03 UTC |
|---|
| Update Date | 2025-03-25 00:48:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169400 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H38N2O2 |
|---|
| Molecular Mass | 362.2933 |
|---|
| SMILES | CCCCCCN(CC(C)C)CC(O)C(Cc1ccccc1)NC(C)=O |
|---|
| InChI Key | CSNCGEIBLKOFEP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsacetamidesamino acids and derivativesamphetamines and derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupamino acid or derivativescarboxylic acid derivativeorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundtertiary amineacetamideamphetamine or derivativesalcohol1,2-aminoalcoholtertiary aliphatic aminecarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
