| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:06 UTC |
|---|
| Update Date | 2025-03-25 00:48:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169502 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H28N2O3S |
|---|
| Molecular Mass | 388.1821 |
|---|
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2c(C)cccc2C)cc1 |
|---|
| InChI Key | FKMKTDTWBTUVLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | benzanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsbenzamidesbenzenesulfonamidesbenzenesulfonyl compoundsbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonamidessecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | organosulfonic acid or derivativesbenzanilidebenzoylorganosulfur compoundcarboxylic acid derivativebenzamideorganosulfonic acid amidexyleneorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl groupbenzenesulfonamideaminosulfonyl compoundm-xylenebenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
