| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:07 UTC |
|---|
| Update Date | 2025-03-25 00:48:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169567 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16N2O4 |
|---|
| Molecular Mass | 288.111 |
|---|
| SMILES | CCOc1ccccc1NC(=O)CNC(=O)c1ccco1 |
|---|
| InChI Key | MCZUHEAICQEKCF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-heteroaryl carboxamidesalkyl aryl ethersalpha amino acid amidesalpha amino acidsanilidescarbonyl compoundscarboxylic acids and derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | furanphenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundn-arylamidealkyl aryl ether2-heteroaryl carboxamideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundfuroic acid or derivativesalpha-amino acid amiden-acyl-alpha-amino acidheteroaromatic compoundcarboxamide groupanilideoxacyclesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
