| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:07 UTC |
|---|
| Update Date | 2025-03-25 00:48:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169574 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H13O5PS3 |
|---|
| Molecular Mass | 267.9663 |
|---|
| SMILES | CCO[PH](=S)(=S)O[SH](=O)(O)OCC |
|---|
| InChI Key | JEJHTESGOJZQTG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | thiophosphoric acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | aliphatic acyclic compoundorganic oxideorganic oxygen compoundthiophosphoric acid esterhydrocarbon derivativeorganooxygen compound |
|---|
