| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:08 UTC |
|---|
| Update Date | 2025-03-25 00:48:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169604 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7F6O5P |
|---|
| Molecular Mass | 303.9935 |
|---|
| SMILES | CCOP(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(=O)O |
|---|
| InChI Key | AJDNRZPDCGVIDT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | halogenated fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-halocarboxylic acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganophosphorus compoundsorganopnictogen compoundsphosphonic acid estersshort-chain hydroxy acids and derivatives |
|---|
| Substituents | halogenated fatty acidalpha-halocarboxylic acid or derivativesaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidalkyl fluorideorganofluoridealpha-halocarboxylic acidcarboxylic acid derivativeorganohalogen compoundphosphonic acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundalkyl halidehydrocarbon derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|
