| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:09 UTC |
|---|
| Update Date | 2025-03-25 00:48:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169644 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15O4PS |
|---|
| Molecular Mass | 274.0429 |
|---|
| SMILES | CCOP(=S)(OC(C)=O)Oc1ccccc1C |
|---|
| InChI Key | QXMHRQYDSZEWLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic thiophosphoric acids and derivatives |
|---|
| Subclass | thiophosphoric acid esters |
|---|
| Direct Parent | phenyl thiophosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetate saltscarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic saltsphenoxy compoundsthiophosphate triesterstoluenes |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupacetate saltphenyl thiophosphatecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidthiophosphate triesterphenoxy compoundorganic salttolueneorganooxygen compound |
|---|