| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:11 UTC |
|---|
| Update Date | 2025-03-25 00:48:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169719 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H30O |
|---|
| Molecular Mass | 286.2297 |
|---|
| SMILES | CCc1cc2c(cc1C)CCC1C2(C)CCC(O)C1(C)C |
|---|
| InChI Key | VBBSSPNVGJWKEB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | diterpenoids |
|---|
| Direct Parent | diterpenoids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | cyclic alcohols and derivativeshydrocarbon derivativesphenanthrenes and derivativessecondary alcoholstetralins |
|---|
| Substituents | alcoholtetralinphenanthreneabietane diterpenoidaromatic homopolycyclic compoundcyclic alcoholorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidditerpenoidorganooxygen compound |
|---|
