| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:13 UTC |
|---|
| Update Date | 2025-03-25 00:48:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169788 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14O6 |
|---|
| Molecular Mass | 230.079 |
|---|
| SMILES | CCOC(=O)C1=CC(O)CC(O)(C(=O)O)C1 |
|---|
| InChI Key | HFINXJKDFHPIEC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | dicarboxylic acids and derivatives |
|---|
| Direct Parent | dicarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsenoate estershydrocarbon derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | enoate esteralcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidhydroxy acidalpha,beta-unsaturated carboxylic estertertiary alcoholorganic oxideorganic oxygen compoundcarboxylic acid estersecondary alcoholaliphatic homomonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|