| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:16 UTC |
|---|
| Update Date | 2025-03-25 00:48:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169909 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H21BrN2O2 |
|---|
| Molecular Mass | 400.0786 |
|---|
| SMILES | CCOC(=O)N1CCC(=C(c2ccc(Br)cc2)c2cccnc2)CC1 |
|---|
| InChI Key | PUQQVSMRLLDCLC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinecarboxylic acids and derivatives |
|---|
| Direct Parent | piperidinecarboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl bromidesazacyclic compoundsbromobenzenescarbamate esterscarbonyl compoundsheteroaromatic compoundshydrocarbon derivativesmethylpyridinesorganic carbonic acids and derivativesorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compoundspiperidines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinecarboxylic acidcarbonic acid derivativeazacycleheteroaromatic compoundcarbamic acid esterbromobenzenemethylpyridinearyl halidepyridineorganic oxygen compoundorganobromidehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenearyl bromideorganooxygen compound |
|---|