| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:16 UTC |
|---|
| Update Date | 2025-03-25 00:48:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169911 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17N3O4S |
|---|
| Molecular Mass | 323.094 |
|---|
| SMILES | CCOC(=O)N1CCN(C2=NS(=O)(=O)c3ccccc32)CC1 |
|---|
| InChI Key | DOTRBEARRZVYEX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzothiazoles |
|---|
| Subclass | benzothiazoles |
|---|
| Direct Parent | benzothiazoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amidinesazacyclic compoundsbenzenoidscarbamate esterscarbonyl compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acids and derivativespiperazine carboxylic acidspiperazines |
|---|
| Substituents | piperazine-1-carboxylic acidorganosulfonic acid or derivativescarbonyl groupcarbonic acid derivativeazacyclecarbamic acid esteramidine1,2-benzothiazoleorganic oxideorganic oxygen compoundpiperazinearomatic heteropolycyclic compoundorganic sulfonic acid or derivatives1,4-diazinaneorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundimidolactamorganooxygen compound |
|---|
