| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:16 UTC |
|---|
| Update Date | 2025-03-25 00:48:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02169913 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22N2O4 |
|---|
| Molecular Mass | 294.158 |
|---|
| SMILES | CCOC(=O)N1CCC(C(O)c2ccc(OC)nc2)CC1 |
|---|
| InChI Key | CRUPDHHKFMFKBG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | piperidinecarboxylic acids and derivatives |
|---|
| Direct Parent | piperidinecarboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl aryl ethersaromatic alcoholsazacyclic compoundscarbamate esterscarbonyl compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinespolyhalopyridinessecondary alcohols |
|---|
| Substituents | aromatic alcoholcarbonyl groupetheraromatic heteromonocyclic compoundpolyhalopyridinealkyl aryl etherorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinecarboxylic acid2-halopyridinealcoholcarbonic acid derivativeazacycleheteroaromatic compoundhydroxypyridinecarbamic acid estermethylpyridinepyridineorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
