Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:46:17 UTC |
---|
Update Date | 2025-03-25 00:48:44 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02169946 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C12H21NO13S |
---|
Molecular Mass | 419.0734 |
---|
SMILES | CC(=O)NC1C(O)C(OS(=O)(=O)O)CC(O)(C(=O)O)OC1C(O)C(O)CO |
---|
InChI Key | QKSNSAFLXFZLON-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | oxepanes |
---|
Subclass | oxepanes |
---|
Direct Parent | oxepanes |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | acetamidesalkyl sulfatesalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativeorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalprimary alcoholacetamidealcoholorganic sulfuric acid or derivativeshydroxy acidcarboxamide groupoxepaneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|