| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:24 UTC |
|---|
| Update Date | 2025-03-25 00:48:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02170188 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H25NO11 |
|---|
| Molecular Mass | 395.1428 |
|---|
| SMILES | CC(=O)NC1C(O)CC(C(=O)O)C(O)C1OC(C(O)CO)C(O)C(O)C=O |
|---|
| InChI Key | DBPMEXWVHCDKLJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalpha-hydroxyaldehydesbeta hydroxy acids and derivativesbeta-hydroxy aldehydescarboxylic acidscyclitols and derivativesdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | beta-hydroxy aldehydecarbonyl groupethercarboxylic acidmonosaccharidecarboxylic acid derivativedialkyl etherbeta-hydroxy acidsaccharideorganic oxidealpha-hydroxyaldehydeorganonitrogen compoundorganopnictogen compoundprimary alcoholacetamidecyclohexanolaldehydecyclitol or derivativeshydroxy acidcyclic alcoholcarboxamide groupsecondary carboxylic acid amidemonocarboxylic acid or derivativesaliphatic homomonocyclic compoundhydrocarbon derivativeorganic nitrogen compound |
|---|
