Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:46:36 UTC |
---|
Update Date | 2025-03-25 00:48:52 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02170666 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C20H33NO4 |
---|
Molecular Mass | 351.241 |
---|
SMILES | COC(=O)CCCC=CCC=CCC=CCCCCC(=O)NCCO |
---|
InChI Key | AJOPUTZUBOHYKU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic nitrogen compounds |
---|
Class | organonitrogen compounds |
---|
Subclass | amines |
---|
Direct Parent | n-acylethanolamines |
---|
Geometric Descriptor | aliphatic acyclic compounds |
---|
Alternative Parents | alcohols and polyolsalkanolaminescarbonyl compoundsfatty acid methyl estershydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
---|
Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl groupfatty amidecarboxamide groupn-acylethanolaminecarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amidefatty acid esterorganic oxidemonocarboxylic acid or derivativesfatty acid methyl estermethyl esterorganic oxygen compoundcarboxylic acid esterorganopnictogen compoundhydrocarbon derivativeorganooxygen compound |
---|