| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:36 UTC |
|---|
| Update Date | 2025-03-25 00:48:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02170676 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H22O7 |
|---|
| Molecular Mass | 374.1366 |
|---|
| SMILES | COC(=O)CCc1c(CCC(=O)O)c(CCC(=O)O)c(O)c2ccccc12 |
|---|
| InChI Key | UZFRUUGYPPSPCG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsfatty acid estershydrocarbon derivativesmethyl estersorganic oxidestricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidaromatic homopolycyclic compoundtricarboxylic acid or derivativescarboxylic acid derivativefatty acid esterorganic oxidemethyl esterorganic oxygen compoundcarboxylic acid esterhydrocarbon derivative1-naphtholorganooxygen compound |
|---|
