| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:37 UTC |
|---|
| Update Date | 2025-03-25 00:48:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02170712 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17NO4 |
|---|
| Molecular Mass | 251.1158 |
|---|
| SMILES | COC(=O)C1Cc2cc(OC)c(O)cc2CN1C |
|---|
| InChI Key | AGWCQFFTCOVPDR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid esters |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersalpha amino acidsanisolesaralkylaminesazacyclic compoundscarbonyl compoundshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundstetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | phenol ethercarbonyl groupether1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraralkylamineorganic oxidemethyl esteraromatic heteropolycyclic compoundorganonitrogen compoundtetrahydroisoquinolinealpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundalpha-amino acid esterazacycletertiary aliphatic aminemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|