| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:42 UTC |
|---|
| Update Date | 2025-03-25 00:48:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02170900 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9N3O3 |
|---|
| Molecular Mass | 195.0644 |
|---|
| SMILES | CNc1ccc(C(N)=O)cc1[N+](=O)[O-] |
|---|
| InChI Key | WNOSSDZXZJHRNE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesnitroaromatic compoundsnitrobenzenesorganic oxidesorganic oxoanionic compoundsorganic oxoazanium compoundsorganooxygen compoundsorganopnictogen compoundsphenylalkylaminesprimary carboxylic acid amidespropargyl-type 1,3-dipolar organic compoundssecondary alkylarylamines |
|---|
| Substituents | primary carboxylic acid amideamino acid or derivativesallyl-type 1,3-dipolar organic compoundbenzoylcarboxylic acid derivativebenzamideorganic nitro compoundpropargyl-type 1,3-dipolar organic compoundorganic oxidec-nitro compoundorganonitrogen compoundorganopnictogen compoundorganic oxoazaniumnitrobenzenenitroaromatic compoundorganic 1,3-dipolar compoundsecondary aminecarboxamide groupsecondary aliphatic/aromatic aminearomatic homomonocyclic compoundorganic oxygen compoundphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compoundorganic hyponitrite |
|---|