| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:43 UTC |
|---|
| Update Date | 2025-03-25 00:48:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02170917 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12N2O2S |
|---|
| Molecular Mass | 236.0619 |
|---|
| SMILES | CNc1cccc2cc(S(N)(=O)=O)ccc12 |
|---|
| InChI Key | YNTASLXYTWCASE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 2-naphthalene sulfonamides |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 2-naphthalene sulfonic acids and derivativesaminosulfonyl compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonamidessecondary alkylarylamines |
|---|
| Substituents | organosulfonic acid or derivativesaminosulfonyl compoundaromatic homopolycyclic compoundsecondary amineorganosulfur compound2-naphthalene sulfonamidesecondary aliphatic/aromatic amineorganosulfonic acid amide2-naphthalene sulfonic acid or derivativesorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundamine |
|---|