| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:43 UTC |
|---|
| Update Date | 2025-03-25 00:48:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02170923 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17NO3 |
|---|
| Molecular Mass | 247.1208 |
|---|
| SMILES | CNCC(O)c1cc(OC)c(O)c2ccccc12 |
|---|
| InChI Key | QSYZJWWGIUVVLD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaromatic alcoholsdialkylamineshydrocarbon derivativesorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholphenol ethersecondary aliphatic amineetheraromatic homopolycyclic compoundalkyl aryl ethersecondary amineorganic oxygen compoundanisoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivative1-naphtholorganic nitrogen compoundorganooxygen compoundamine |
|---|
