| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:43 UTC |
|---|
| Update Date | 2025-03-25 00:48:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02170935 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15NO7S |
|---|
| Molecular Mass | 305.0569 |
|---|
| SMILES | CNCC(O)c1ccc(OS(=O)(=O)OC(C)=O)c(O)c1 |
|---|
| InChI Key | KVYNHRBWQSBHRK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetate saltsamino acids and derivativesaromatic alcoholscarbonyl compoundsdialkylamineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic saltsorganopnictogen compoundsphenoxy compoundssecondary alcoholssulfuric acid diesters |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietycarbonyl groupamino acid or derivativesacetate salt1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidesulfuric acid diesterorganonitrogen compoundorganopnictogen compoundarylsulfateorganic saltalcoholsecondary aliphatic amine1-hydroxy-4-unsubstituted benzenoidsecondary aminearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compoundamine |
|---|
