| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:45 UTC |
|---|
| Update Date | 2025-03-25 00:48:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171001 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO4 |
|---|
| Molecular Mass | 213.1001 |
|---|
| SMILES | COC(=O)C1C(O)CC2CCC1C(=O)N2 |
|---|
| InChI Key | MYJVXHZYPVMTJH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | lactams |
|---|
| Subclass | caprolactams |
|---|
| Direct Parent | caprolactams |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsazepanesbeta hydroxy acids and derivativescarbonyl compoundscyclic alcohols and derivativesdelta lactamshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinonessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | caprolactamcarbonyl groupcarboxylic acid derivativealiphatic heteropolycyclic compoundbeta-hydroxy acidorganic oxidemethyl esterorganonitrogen compoundorganopnictogen compoundpiperidinonepiperidinealcoholazacyclehydroxy acidcyclic alcoholcarboxamide groupdelta-lactamsecondary carboxylic acid amidemonocarboxylic acid or derivativesazepaneorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
