| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:45 UTC |
|---|
| Update Date | 2025-03-25 00:48:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171014 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H14O7S |
|---|
| Molecular Mass | 254.046 |
|---|
| SMILES | COC(=O)C1C(O)CC(O)CC1S(=O)(=O)O |
|---|
| InChI Key | PBXRIWWTGWSQCL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscyclic alcohols and derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganosulfonic acidssulfonyls |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl grouporganosulfonic acidcyclohexanolhydroxy acidcyclic alcoholorganosulfur compoundcarboxylic acid derivativebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativessulfonylmethyl esterorganic sulfonic acid or derivativescarboxylic acid esteraliphatic homomonocyclic compoundhydrocarbon derivative |
|---|
