| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:46 UTC |
|---|
| Update Date | 2025-03-25 00:48:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171031 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O6 |
|---|
| Molecular Mass | 190.0477 |
|---|
| SMILES | COC(=O)C(=O)C(C)(O)C(=O)OC |
|---|
| InChI Key | AMMVAACTPPOYKW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | beta-keto acids and derivatives |
|---|
| Direct Parent | beta-keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesalpha-keto acids and derivativesdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesmethyl estersorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl groupalpha-hydroxy ketonecarboxylic acid derivativebeta-keto acidketonefatty acid estertertiary alcoholorganic oxidemethyl esterorganic oxygen compoundacyloincarboxylic acid esteralpha-keto aciddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
