| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:46 UTC |
|---|
| Update Date | 2025-03-25 00:48:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171032 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O7 |
|---|
| Molecular Mass | 254.0427 |
|---|
| SMILES | COC(=O)C(=O)CC(=O)c1c(O)cc(O)cc1O |
|---|
| InChI Key | MYJYSHZEIKLYDZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalpha-keto acids and derivativesaryl alkyl ketonesbenzoyl derivativesbutyrophenonesfatty acid estersgamma-keto acids and derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesvinylogous acids |
|---|
| Substituents | fatty acylmonocyclic benzene moietyaryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativephloroglucinol derivativeorganic oxidemethyl esteralpha-keto acidacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidgamma-keto acidbutyrophenonearomatic homomonocyclic compoundfatty acid estervinylogous acidmonocarboxylic acid or derivativesketo acidcarboxylic acid esterphenolhydrocarbon derivativebenzenoidalkyl-phenylketone |
|---|
