| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:47 UTC |
|---|
| Update Date | 2025-03-25 00:48:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171072 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H32O15 |
|---|
| Molecular Mass | 608.1741 |
|---|
| SMILES | COc1cc(-c2coc3c(O)c(OC4OC(COC5OC(C)C(O)C(O)C5O)C(O)C(O)C4O)ccc3c2=O)ccc1O |
|---|
| InChI Key | VOMDIEUCKVVOTP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavonoid o-glycosides |
|---|
| Direct Parent | isoflavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl aryl ethersanisoleschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesmethoxybenzenesmethoxyphenolsmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundspyranones and derivativessecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidisoflavonoid-7-o-glycosidemethoxyphenolmonosaccharidealkyl aryl ethersaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundpyranoneoxaneorganoheterocyclic compoundisoflavonealcoholbenzopyranheteroaromatic compoundisoflavonoid o-glycoside1-hydroxy-4-unsubstituted benzenoidmethoxybenzeneoxacycleorganic oxygen compoundpyrananisolesecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|