| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:47 UTC |
|---|
| Update Date | 2025-03-25 00:48:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171089 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O3 |
|---|
| Molecular Mass | 266.0943 |
|---|
| SMILES | COc1c(O)ccc2ccc(-c3ccc(O)cc3)cc12 |
|---|
| InChI Key | SDKRRWFDGRQSHY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | phenylnaphthalenes |
|---|
| Direct Parent | phenylnaphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzene and substituted derivativeshydrocarbon derivativesnaphthols and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundalkyl aryl etherorganic oxygen compoundphenylnaphthaleneanisolephenolhydrocarbon derivative2-naphtholorganooxygen compound |
|---|