Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:46:53 UTC |
---|
Update Date | 2025-03-25 00:49:00 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02171338 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C13H23NO17S2 |
---|
Molecular Mass | 529.0407 |
---|
SMILES | COC1C(C(=O)O)OC(OC2C(O)C(O)C(NS(=O)(=O)O)C(O)C2O)C(OS(=O)(=O)O)C1O |
---|
InChI Key | FIIUNDGCMAEIQS-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsalkyl sulfatescarbonyl compoundscarboxylic acidscyclamatescyclitols and derivativescyclohexanolsdialkyl ethersglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssulfuric acid monoamidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl groupethercarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl ether1-o-glucuronideorganic oxideacetalalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesorganic sulfuric acid or derivativescyclohexanolcyclamic_acid_derivativecyclitol or derivativescyclic alcoholoxacyclemonocarboxylic acid or derivativespyransulfuric acid monoamidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
---|