| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:56 UTC |
|---|
| Update Date | 2025-03-25 00:49:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171423 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N2O9P |
|---|
| Molecular Mass | 324.0359 |
|---|
| SMILES | COC1OC(COP(=O)(O)O)OC1n1ccc(=O)[nH]c1=O |
|---|
| InChI Key | HNHVMLBHKGZZNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | nucleoside and nucleotide analogues |
|---|
| Direct Parent | nucleoside and nucleotide analogues |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesacetalsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonesvinylogous amides |
|---|
| Substituents | meta-dioxolanelactamaromatic heteromonocyclic compoundpyrimidonepyrimidineorganic oxideacetalorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
