| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:59 UTC |
|---|
| Update Date | 2025-03-25 00:49:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171545 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H31N5O2S |
|---|
| Molecular Mass | 381.2198 |
|---|
| SMILES | CN(C)Cc1ccc(CSCCNC(=N)NCCCC(N)C(=O)O)cc1 |
|---|
| InChI Key | JDXBVYIWSUVTJQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | arginine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsaralkylaminesbenzylaminescarbonyl compoundscarboximidamidescarboxylic acidsdialkylthioethersguanidineshydrocarbon derivativesiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenylmethylaminessulfenyl compoundstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidamino acidguanidineimineorganosulfur compoundaralkylamineorganic oxidearginine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary aminesulfenyl compounddialkylthioethertertiary aliphatic aminecarboximidamidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesphenylmethylamineorganic oxygen compoundbenzylaminethioetherhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
