| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:59 UTC |
|---|
| Update Date | 2025-03-25 00:49:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171559 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13NO4 |
|---|
| Molecular Mass | 247.0845 |
|---|
| SMILES | CN1C(=O)C2COC(c3ccc(O)cc3)C2C1=O |
|---|
| InChI Key | RFZJIUCQDVHGCY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdialkyl ethersdicarboximideshydrocarbon derivativesn-alkylpyrrolidinesn-substituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrrolidine-2-onestetrahydrofurans |
|---|
| Substituents | 2-pyrrolidonemonocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativedialkyl etherorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximidepyrrolidinecarboxylic acid imide, n-substitutedpyrrolidoneorganoheterocyclic compoundazacyclen-alkylpyrrolidinetetrahydrofurancarboxylic acid imideoxacycleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
