| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:46:59 UTC |
|---|
| Update Date | 2025-03-25 00:49:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171570 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13ClFN3O |
|---|
| Molecular Mass | 317.0731 |
|---|
| SMILES | CN1C(=N)NC(c2ccc(F)cc2)(c2ccc(Cl)cc2)C1=O |
|---|
| InChI Key | XFCKJWNAOWZAEZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaryl chloridesaryl fluoridesazacyclic compoundscarbonyl compoundscarboximidamidescarboxylic acids and derivativeschlorobenzenesfluorobenzenesguanidineshydrocarbon derivativesimidazolidinonesiminesorganic oxidesorganochloridesorganofluoridesorganopnictogen compoundsphenylimidazolidines |
|---|
| Substituents | aryl fluorideimidazolidinediphenylmethanecarbonyl groupphenylimidazolidinearomatic heteromonocyclic compoundguanidineimineorganochloridealpha-amino acid or derivativescarboxylic acid derivativeorganohalogen compoundimidazolidinonefluorobenzeneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundaryl chloridechlorobenzeneazacycleorganofluoridecarboximidamidearyl halideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|