| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:00 UTC |
|---|
| Update Date | 2025-03-25 00:49:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171603 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H16N2O6 |
|---|
| Molecular Mass | 248.1008 |
|---|
| SMILES | CN(CCC(N)C(=O)O)C(CC(=O)O)C(=O)O |
|---|
| InChI Key | NLUYFEPOCFQKFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsamino fatty acidscarbonyl compoundscarboxylic acidsfatty acylshydrocarbon derivativesmonoalkylaminesorganic oxidesorganopnictogen compoundstrialkylaminestricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidamino acidtertiary aliphatic aminetricarboxylic acid or derivativesamino fatty acidorganic oxideorganic oxygen compoundalpha-amino acidaspartic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
