| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:01 UTC |
|---|
| Update Date | 2025-03-25 00:49:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171628 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H22N2O4S |
|---|
| Molecular Mass | 314.13 |
|---|
| SMILES | CN(CC(O)C1(O)CCCC1)S(=O)(=O)c1ccc(N)cc1 |
|---|
| InChI Key | AUWIDXOMOPJZTP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaminosulfonyl compoundsbenzenesulfonyl compoundscyclic alcohols and derivativescyclopentanolshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonamidesprimary aminestertiary alcohols |
|---|
| Substituents | organosulfonic acid or derivativesorganosulfur compoundorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compound1,2-diolbenzenesulfonyl groupalcoholbenzenesulfonamideaminosulfonyl compoundcyclic alcoholcyclopentanolaromatic homomonocyclic compoundtertiary alcoholsulfonylorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|