| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:02 UTC |
|---|
| Update Date | 2025-03-25 00:49:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171679 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H8N4O2S |
|---|
| Molecular Mass | 200.0368 |
|---|
| SMILES | CN(C(=N)N)c1nc(C(=O)O)cs1 |
|---|
| InChI Key | LUXUEAFVEOXTRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | thiazoles |
|---|
| Direct Parent | thiazolecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2,4-disubstituted thiazolesazacyclic compoundscarboximidamidescarboxylic acidsguanidinesheteroaromatic compoundshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | carboxylic acidaromatic heteromonocyclic compoundazacycleguanidineimineheteroaromatic compoundcarboximidamidecarboxylic acid derivativethiazolecarboxylic acid or derivativesorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2,4-disubstituted 1,3-thiazoleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
