| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:05 UTC |
|---|
| Update Date | 2025-03-25 00:49:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171800 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H21NO5 |
|---|
| Molecular Mass | 355.142 |
|---|
| SMILES | CN(C)CCCOc1ccc(-c2coc3cc(O)cc(O)c3c2=O)cc1 |
|---|
| InChI Key | BBBNMHFGHVFPPI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl etherschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenol ethersphenoxy compoundspyranones and derivativestrialkylaminesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundorganonitrogen compoundpyranoneorganopnictogen compoundtertiary amineorganoheterocyclic compoundisoflavonebenzopyranheteroaromatic compoundtertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyranhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
