| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:06 UTC |
|---|
| Update Date | 2025-03-25 00:49:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171803 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H25N3O4S |
|---|
| Molecular Mass | 427.1566 |
|---|
| SMILES | CN(C)CCCNC(=O)c1ccc(Nc2cccc3cccc(S(=O)(=O)O)c23)cc1 |
|---|
| InChI Key | GARDFYUZJXIQPX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-naphthalene sulfonates1-sulfo,2-unsubstituted aromatic compoundsamino acids and derivativesarylsulfonic acids and derivativesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsorganosulfonic acidssecondary aminessecondary carboxylic acid amidessulfonylstrialkylamines |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyamino acid or derivativesorganosulfonic acidbenzoylorganosulfur compoundcarboxylic acid derivativebenzamide1-naphthalene sulfonic acid or derivatives1-naphthalene sulfonateorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary amine1-sulfo,2-unsubstituted aromatic compoundtertiary aliphatic aminebenzoic acid or derivativesaromatic homopolycyclic compoundsecondary aminecarboxamide groupsecondary carboxylic acid amidesulfonylorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativesnaphthalene sulfonatehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|