| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:06 UTC |
|---|
| Update Date | 2025-03-25 00:49:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171806 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19N3O2 |
|---|
| Molecular Mass | 261.1477 |
|---|
| SMILES | CN(C)CCN1C(=O)CC(c2ccccc2)NC1=O |
|---|
| InChI Key | RFZVEOWWWFNRGD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | beta amino acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdiazinanesdicarboximideshydrocarbon derivativesn-acyl ureasorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundspyrimidonestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundpyrimidonepyrimidine1,3-diazinaneorganic oxideorganonitrogen compoundorganopnictogen compounddicarboximideureidetertiary amineorganoheterocyclic compoundn-acyl ureacarbonic acid derivativeazacycletertiary aliphatic aminebeta amino acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|