| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:06 UTC |
|---|
| Update Date | 2025-03-25 00:49:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171814 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21N3O |
|---|
| Molecular Mass | 247.1685 |
|---|
| SMILES | CN(C)CCCC1(c2ccccc2)CNC(=O)N1 |
|---|
| InChI Key | HAPAGLDMCGFKCI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsphenylimidazolidinestrialkylamines |
|---|
| Substituents | imidazolidinecarbonyl groupcarbonic acid derivativephenylimidazolidinearomatic heteromonocyclic compoundazacycletertiary aliphatic amineimidazolidinoneorganic oxidephenylbutylamineorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amineorganoheterocyclic compoundorganooxygen compound |
|---|