| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:07 UTC |
|---|
| Update Date | 2025-03-25 00:49:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171864 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N6O4 |
|---|
| Molecular Mass | 322.139 |
|---|
| SMILES | CN(C)CC1OC(c2cnc3nc(N)[nH]c(=O)c3n2)C(O)C1O |
|---|
| InChI Key | JPWOMTPDYFCEKF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary aminespyrazinespyrimidonessecondary alcoholstetrahydrofuranstrialkylamines |
|---|
| Substituents | etherlactammonosaccharidepyrimidonedialkyl etherpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtertiary amine1,2-diolalcoholpterinazacycletetrahydrofuranheteroaromatic compoundtertiary aliphatic amineoxacycleorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
