| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:07 UTC |
|---|
| Update Date | 2025-03-25 00:49:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171867 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O2 |
|---|
| Molecular Mass | 248.1525 |
|---|
| SMILES | CN(C)CC1CCC(c2ccc(C(N)=O)cc2)O1 |
|---|
| InChI Key | MOFHJSFJEKIOBW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzoyl derivativescarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary carboxylic acid amidestetrahydrofuranstrialkylamines |
|---|
| Substituents | primary carboxylic acid amideetheraromatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativedialkyl etherbenzamideorganic oxideorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundtetrahydrofurantertiary aliphatic aminecarboxamide groupoxacycleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
