| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:07 UTC |
|---|
| Update Date | 2025-03-25 00:49:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171874 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12N3O4P |
|---|
| Molecular Mass | 245.0565 |
|---|
| SMILES | CNC(=N)Nc1ccc(OP(=O)(O)O)cc1 |
|---|
| InChI Key | JINYVKZIOFCCAD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phenyl phosphates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carboximidamidesguanidineshydrocarbon derivativesiminesorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietyguanidineiminecarboximidamidephenyl phosphatearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
