| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:08 UTC |
|---|
| Update Date | 2025-03-25 00:49:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02171882 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13N3O5S |
|---|
| Molecular Mass | 239.0576 |
|---|
| SMILES | CNC(=NS(=O)(=O)O)NCCCC(=O)O |
|---|
| InChI Key | DTIOSESEYVXNIL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | gamma amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsguanidineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundsstraight chain fatty acids |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupstraight chain fatty acidcarboxylic acidorganic sulfuric acid or derivativesgamma amino acid or derivativesguanidinefatty acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|