Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:47:08 UTC |
---|
Update Date | 2025-03-25 00:49:05 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02171914 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C18H23NO8 |
---|
Molecular Mass | 381.1424 |
---|
SMILES | CNC(=O)C1OC(Oc2cccc(CC3CCC(=O)O3)c2)C(O)C(O)C1O |
---|
InChI Key | SSEZEHQLBPGZGB-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyrans |
---|
Subclass | pyran carboxylic acids and derivatives |
---|
Direct Parent | pyran carboxylic acids |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | acetalscarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyranssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivativelactonesaccharideorganic oxideacetalorganonitrogen compoundorganopnictogen compoundoxanealcoholpyran carboxylic acid or derivativestetrahydrofurancarboxamide groupgamma butyrolactoneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganooxygen compound |
---|