Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:47:10 UTC |
---|
Update Date | 2025-03-25 00:49:06 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02171984 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C9H18N2O8S |
---|
Molecular Mass | 314.0784 |
---|
SMILES | CNC1C(NC(C)=O)OC(COS(=O)(=O)O)C(O)C1O |
---|
InChI Key | NHPZQMXYNRETPK-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | monosaccharides |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | 1,2-diolsacetamidesalkyl sulfatesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl groupamino acid or derivativesmonosaccharidecarboxylic acid derivativeorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundacetamide1,2-diolalcoholsecondary aliphatic amineorganic sulfuric acid or derivativessecondary aminecarboxamide groupoxacyclesecondary carboxylic acid amidesecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid esteramine |
---|