| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:12 UTC |
|---|
| Update Date | 2025-03-25 00:49:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02172031 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10F3NO |
|---|
| Molecular Mass | 217.0714 |
|---|
| SMILES | CNC(=O)c1cc(C(F)(F)F)ccc1C |
|---|
| InChI Key | QTZBPVBTLIEXEO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | trifluoromethylbenzenes |
|---|
| Direct Parent | trifluoromethylbenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssecondary carboxylic acid amideso-toluamides |
|---|
| Substituents | benzoylcarboxylic acid derivativeorganohalogen compoundtoluamidebenzamideorganic oxideo-toluamideorganonitrogen compoundorganopnictogen compoundalkyl halidetrifluoromethylbenzenealkyl fluorideorganofluoridebenzoic acid or derivativescarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundtolueneorganooxygen compound |
|---|
