| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:14 UTC |
|---|
| Update Date | 2025-03-25 00:49:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02172122 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H17NO3 |
|---|
| Molecular Mass | 283.1208 |
|---|
| SMILES | CN1CC(=O)C(c2ccc(O)cc2)C1c1ccc(O)cc1 |
|---|
| InChI Key | FHJKEDUGLOTTRM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaralkylaminesazacyclic compoundsbenzene and substituted derivativescyclic ketoneshydrocarbon derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsphenylpyrrolidinespyrrolespyrrolidine-3-onestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compound3-pyrrolidone1-hydroxy-2-unsubstituted benzenoidcyclic ketonearalkylamineketoneorganic oxideorganonitrogen compoundorganopnictogen compoundpyrrolidinepyrrolidonetertiary amineorganoheterocyclic compoundazacyclen-alkylpyrrolidine2-phenylpyrrolidinetertiary aliphatic amine3-phenylpyrrolidineorganic oxygen compoundpyrrolephenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compoundstilbene |
|---|