| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:14 UTC |
|---|
| Update Date | 2025-03-25 00:49:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02172130 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H19NO3 |
|---|
| Molecular Mass | 273.1365 |
|---|
| SMILES | CN1C2CC(C(=O)OCc3ccccc3)C1CCC2=O |
|---|
| InChI Key | BNYRGUXWXWGDHL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundscarboxylic acid estershydrocarbon derivativesketonesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundspiperidinonespyrrolidine carboxylic acidstrialkylaminestropane alkaloids |
|---|
| Substituents | benzyloxycarbonylcarbonyl groupamino acid or derivativescarboxylic acid derivativeketoneorganic oxidearomatic heteropolycyclic compoundpyrrolidine carboxylic acidorganonitrogen compoundorganopnictogen compoundpiperidinonepyrrolidinepiperidinetertiary amineorganoheterocyclic compoundazacyclen-alkylpyrrolidinetertiary aliphatic aminemonocarboxylic acid or derivativespyrrolidine carboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganic nitrogen compoundtropane alkaloidamineorganooxygen compound |
|---|