Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:47:14 UTC |
---|
Update Date | 2025-03-25 00:49:08 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02172130 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C16H19NO3 |
---|
Molecular Mass | 273.1365 |
---|
SMILES | CN1C2CC(C(=O)OCc3ccccc3)C1CCC2=O |
---|
InChI Key | BNYRGUXWXWGDHL-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzyloxycarbonyls |
---|
Direct Parent | benzyloxycarbonyls |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | amino acids and derivativesazacyclic compoundscarboxylic acid estershydrocarbon derivativesketonesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundspiperidinonespyrrolidine carboxylic acidstrialkylaminestropane alkaloids |
---|
Substituents | benzyloxycarbonylcarbonyl groupamino acid or derivativescarboxylic acid derivativeketoneorganic oxidearomatic heteropolycyclic compoundpyrrolidine carboxylic acidorganonitrogen compoundorganopnictogen compoundpiperidinonepyrrolidinepiperidinetertiary amineorganoheterocyclic compoundazacyclen-alkylpyrrolidinetertiary aliphatic aminemonocarboxylic acid or derivativespyrrolidine carboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganic nitrogen compoundtropane alkaloidamineorganooxygen compound |
---|