| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:16 UTC |
|---|
| Update Date | 2025-03-25 00:49:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02172177 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11NO7S |
|---|
| Molecular Mass | 253.0256 |
|---|
| SMILES | CC(=O)NC1C(=O)C(OS(=O)(=O)O)CC1O |
|---|
| InChI Key | ZYSBFSWLTADJIB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclopentanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl sulfatescarboxylic acids and derivativescyclic alcohols and derivativescyclic ketoneshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcyclic ketonecarboxylic acid derivativeketoneorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundacetamideorganic sulfuric acid or derivativescyclic alcoholcarboxamide groupcyclopentanolsecondary carboxylic acid amidealiphatic homomonocyclic compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
|---|
