| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:16 UTC |
|---|
| Update Date | 2025-03-25 00:49:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02172179 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13NO9S |
|---|
| Molecular Mass | 299.0311 |
|---|
| SMILES | CC(=O)NC1C(=O)C(OS(=O)(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | OJAAGYCTUHGGCZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | aminosaccharides |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl sulfatescarboxylic acids and derivativescyclic ketonescyclitols and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcyclic ketonecarboxylic acid derivativeketoneorganic oxidealkyl sulfateorganonitrogen compoundorganopnictogen compoundacetamidealcoholamino saccharideorganic sulfuric acid or derivativescyclitol or derivativescyclic alcoholcarboxamide groupsecondary carboxylic acid amidesecondary alcoholaliphatic homomonocyclic compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid ester |
|---|