| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:25 UTC |
|---|
| Update Date | 2025-03-25 00:49:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02172527 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H21NO2 |
|---|
| Molecular Mass | 307.1572 |
|---|
| SMILES | CCC1=C(C)C(=O)NC1Cc1cccc(Oc2ccccc2)c1 |
|---|
| InChI Key | NNCMAQJHNUWMTF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdiarylethershydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundspyrrolinessecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupetherlactamaromatic heteromonocyclic compoundazacyclecarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amideorganic oxideorganic oxygen compoundpyrrolineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compounddiphenyletherorganoheterocyclic compoundorganooxygen compound |
|---|
